M9201534
Aceclidinehydrochloride , ≥98%(HPLC) , 6109-70-2
Synonym(s):
1-Azabicyclo[2.2.2]oct-3-yl acetate hydrochloride;3-Acetoxyquinuclidine hydrochloride
CAS NO.:6109-70-2
Empirical Formula: C9H16ClNO2
Molecular Weight: 205.68
MDL number: MFCD00136230
EINECS: 228-071-5
| Pack Size | Price | Stock | Quantity |
| 10mg | RMB535.20 | In Stock |
|
| 50mg | RMB2121.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166°C |
| storage temp. | -20°C Freezer |
| solubility | H2O: ≥15mg/mL at ~60°C |
| form | powder |
| color | white to tan |
| Water Solubility | H2O: ≥15mg/mL at~60°C |
| Stability: | Moisture Sensitive |
| InChI | InChI=1/C9H15NO2.ClH/c1-7(11)12-9-6-10-4-2-8(9)3-5-10;/h8-9H,2-6H2,1H3;1H |
| InChIKey | LWWSARSTZGNKGV-UHFFFAOYNA-N |
| SMILES | C1(OC(=O)C)CN2CC[C@]1([H])CC2.Cl |&1:9,r| |
Description and Uses
Glaucoma;Parasympatho-
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H311 |
| Precautionary statements | P280-P301+P310-P312 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| RTECS | VD6198000 |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral |





