A1040650
4,4'-Diaminodiphenylmethane-3,3'-dicarboxylicacid , >98%(HPLC) , 7330-46-3
CAS NO.:7330-46-3
Empirical Formula: C15H14N2O4
Molecular Weight: 286.28
MDL number: MFCD00059640
EINECS: 230-830-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 5g | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 262℃ (water acetic acid ) |
| Boiling point: | 576.4±50.0 °C(Predicted) |
| Density | 1.442±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 2.24±0.10(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C15H14N2O4/c16-12-3-1-8(6-10(12)14(18)19)5-9-2-4-13(17)11(7-9)15(20)21/h1-4,6-7H,5,16-17H2,(H,18,19)(H,20,21) |
| InChIKey | QRUWUSOUUMPANJ-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(N)=C(C=1)C(O)=O)C1C=CC(N)=C(C=1)C(O)=O |
Description and Uses
5,5'-Methylenebis(2-aminobenzoic Acid) (MBA) is a polymer monomer used in the synthesis of polyimides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |





