A1050050
1-Butyl-1-methylpyrrolidiniumtetrafluoroborate , ≥95% , 345984-11-4
Synonym(s):
N-n-Butyl-N-methylpyrrolidinium tetrafluoroborate;Butylmethylpyrrolidinium tetrafluoroborate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB223.20 | In Stock |
|
| 25g | RMB518.40 | In Stock |
|
| 100g | RMB1215.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150 °C |
| form | crystals |
| color | White |
| Major Application | battery manufacturing |
| InChI | 1S/C9H20N.BF4/c1-3-4-7-10(2)8-5-6-9-10;2-1(3,4)5/h3-9H2,1-2H3;/q+1;-1 |
| InChIKey | PGCVCJOPLBWQHU-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CCCC[N+]1(C)CCCC1 |
Description and Uses
Ionic liquids (ILs) are molten salts with melting points lower than 100 °C. They usually consist of pair of organic cation and anion. ILs exhibit unique properties such as nonvolatility, high thermal stability, and high ionic conductivity and find applications as electrolytes in lithium/sodium ion batteries and dye-sensitized solar cells. They are also used as media for synthesis of conducting polymers and intercalation electrode materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
