A1124012
2-Amino-6-chlorophenol , 98% , 38191-33-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB34.40 | In Stock |
|
| 1G | RMB87.20 | In Stock |
|
| 5G | RMB392.00 | In Stock |
|
| 25G | RMB1688.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-81℃ |
| Boiling point: | 247℃ |
| Density | 1.406 |
| Flash point: | 103℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 8.28±0.10(Predicted) |
| color | Grey |
| InChI | InChI=1S/C6H6ClNO/c7-4-2-1-3-5(8)6(4)9/h1-3,9H,8H2 |
| InChIKey | QUIIUKFPLUUSGQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C=CC=C1N |
Description and Uses
2-Amino-6-Chlorophenol is used to synthesize HT2C receptor agonists with high selectivity in functional and binding assays.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P312-P260-P280 |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







![2-[2,4-Bis(tert-pentyl)phenoxy]-N-(3,5-dichloro-2-hydroxy-p-tolyl)butyramide](https://img.chemicalbook.com/CAS/GIF/31037-84-0.gif)