PRODUCT Properties
| Melting point: | 110-114 °C (lit.) |
| InChI | 1S/C6H3ClN2O5/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14/h1-2,10H |
| InChIKey | PCBCIXWBAPIVDV-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(cc1[N+]([O-])=O)[N+]([O-])=O |
| CAS DataBase Reference | 946-31-6(CAS DataBase Reference) |
Description and Uses
2-Chloro-4,6-dinitrophenol was used in identification of components in chemical waste water and in effluents from biological wastewater treatment plant using electrospray ionization and tandem mass spectrometry.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 2 |
| RTECS | SK4200000 |
| HS Code | 2908990000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
