A1184712
Barium trifluoromethanesulfonate , 98% , 2794-60-7
Synonym(s):
Barium triflate;Trifluoromethanesulfonic acid barium salt
CAS NO.:2794-60-7
Empirical Formula: C2BaF6O6S2
Molecular Weight: 435.47
MDL number: MFCD00143644
EINECS: 220-526-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB109.60 | In Stock |
|
| 25G | RMB389.60 | In Stock |
|
| 100G | RMB1196.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | white |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 5: forms reversible hydrate |
| BRN | 3729346 |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| Stability: | hygroscopic |
| InChI | InChI=1S/2CHF3O3S.Ba/c2*2-1(3,4)8(5,6)7;/h2*(H,5,6,7);/q;;+2/p-2 |
| InChIKey | DXJURUJRANOYMX-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S([O-])(=O)=O.[Ba+2] |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, barium salt (2794-60-7) |
Description and Uses
Ba(CF3SO3) can be utilized as a precursor to synthesize:
- Alkali metal and silver trifluoromethanesulfonates.
- Sodium trifluoromethanesulfonate (sodium triflate) by reacting with sodium sulfate. Sodium triflate finds application in organic synthesis as an efficient catalyst as well as a reactant in catalytic asymmetric Mannich-type reactions, and Diels-Alder reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H332 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 28 |
| RIDADR | UN 1564 6.1/PG 3 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049020 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |







