A1185212
N-(tert-Butoxycarbonyl)-D-3-chlorophenylalanine , 98% , 80102-25-6
Synonym(s):
Boc-3-chloro-D -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB57.60 | In Stock |
|
| 1G | RMB144.80 | In Stock |
|
| 5G | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110°C |
| Boiling point: | 452.5±40.0 °C(Predicted) |
| Density | 1.245 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.81±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1 |
| InChIKey | RCZHBTHQISEPPP-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1cccc(Cl)c1)C(O)=O |
| CAS DataBase Reference | 80102-25-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
