A1191112
6-Bromoquinoline , 96% , 5332-25-2
CAS NO.：5332-25-2
Empirical Formula: C9H6BrN
Molecular Weight: 208.05
MDL number: MFCD00024023
EINECS: 226-238-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB130.40 | In Stock |
|
| 100G | RMB421.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 19°C |
| Boiling point: | 116 °C / 6mmHg |
| Density | 1.538 g/mL at 25 °C |
| refractive index | n20/D 1.663 |
| Flash point: | 19 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in acetone, acetonitrile, dichloromethane, ethyl acetate and THF. |
| pka | 4.18±0.10(Predicted) |
| form | Oil |
| color | Light yellow to brown |
| InChI | InChI=1S/C9H6BrN/c10-8-3-4-9-7(6-8)2-1-5-11-9/h1-6H |
| InChIKey | IFIHYLCUKYCKRH-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C=CC=1 |
| CAS DataBase Reference | 5332-25-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Bromo quinoline(5332-25-2) |
| EPA Substance Registry System | Quinoline, 6-bromo- (5332-25-2) |
Description and Uses
6-Bromoquinoline is used as fine chemical and pharmaceutical intermediate, used as the coupling reagent.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22-20/21/22 |
| Safety Statements | 26-37/39-39-36 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
