A1387812
2-Bromoquinoline , 98% , 2005-43-8
CAS NO.:2005-43-8
Empirical Formula: C9H6BrN
Molecular Weight: 208.05
MDL number: MFCD00234480
EINECS: 679-582-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB170.40 | In Stock |
|
| 25G | RMB569.60 | In Stock |
|
| 100g | RMB2173.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-48 °C |
| Boiling point: | 115°C/0.3mmHg(lit.) |
| Density | 1.564±0.06 g/cm3(Predicted) |
| Flash point: | >110℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | 0.58±0.40(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| λmax | 319nm(EtOH)(lit.) |
| InChI | InChI=1S/C9H6BrN/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| InChIKey | QKJAZPHKNWSXDF-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C=CC=1Br |
| CAS DataBase Reference | 2005-43-8(CAS DataBase Reference) |
Description and Uses
2-Bromoquinoline is used as a reagent in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-41-37/38-22 |
| Safety Statements | 26-36-39-22 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





