A1192412
4-Bromo-2-fluoroanisole , 98% , 2357-52-0
Synonym(s):
4-Bromo-2-fluoro-1-methoxybenzene
CAS NO.:2357-52-0
Empirical Formula: C7H6BrFO
Molecular Weight: 205.02
MDL number: MFCD00011710
EINECS: 219-096-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB204.80 | In Stock |
|
| 500g | RMB927.20 | In Stock |
|
| 1kg | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16 °C |
| Boiling point: | 84 °C/7 mmHg (lit.) |
| Density | 1.59 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 209 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.590 |
| Water Solubility | insoluble |
| BRN | 3240714 |
| InChI | InChI=1S/C7H6BrFO/c1-10-7-3-2-5(8)4-6(7)9/h2-4H,1H3 |
| InChIKey | DWNXGZBXFDNKOR-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 2357-52-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-2-fluoroanisole(2357-52-0) |
Description and Uses
4-Bromo-2-fluoroanisole has been used in the synthesis of:
- 1,4-bis[(3′-fluoro-4′-n alkoxyphenyl)ethynyl]benzenes with n=1-12
- 7-fluoro-6-methoxy-1-methyl-2-naphthaldehyde
- 5,7-difluoro-6-methoxy-1-methyl-2-naphthaldehyde
- liquid crystals with terminal difluoromethoxy group and backbone of phenylbicyclohexane
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29093090 |





