A1194812
Bis(2-nitrophenyl) disulfide , 98% , 1155-00-6
Synonym(s):
2-Nitrophenyl disulfide
CAS NO.:1155-00-6
Empirical Formula: C12H8N2O4S2
Molecular Weight: 308.33
MDL number: MFCD00007130
EINECS: 214-581-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB40.80 | In Stock |
|
| 100G | RMB120.00 | In Stock |
|
| 500G | RMB452.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194-197 °C (lit.) |
| Boiling point: | 441.9±30.0 °C(Predicted) |
| Density | 1.62 g/cm3 (-123.16℃) |
| refractive index | 1.6510 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 1016770 |
| InChI | 1S/C12H8N2O4S2/c15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-8H |
| InChIKey | NXCKJENHTITELM-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccccc1SSc2ccccc2[N+]([O-])=O |
| CAS DataBase Reference | 1155-00-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(o-nitrophenyl)disulfide(1155-00-6) |
| EPA Substance Registry System | Disulfide, bis(2-nitrophenyl) (1155-00-6) |
Description and Uses
Bis(o-Nitrophenyl) Disulfide, can be used in a PVC membrane electrode as a sensor for zinc ions. It is also a building block used for the synthesis of various pharmaceutical compounds. It can be used for the preparation of a series of 4-Azaindole inhibitors of c-Met kinase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29309099 |
| Storage Class | 4.1A - Other explosive hazardous materials |






