A1198012
4-Biphenylcarboxylic Acid , 99% , 92-92-2
Synonym(s):
4-Phenylbenzoic acid
CAS NO.:92-92-2
Empirical Formula: C13H10O2
Molecular Weight: 198.22
MDL number: MFCD00002553
EINECS: 202-203-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB132.00 | In Stock |
|
| 250g | RMB319.20 | In Stock |
|
| 500g | RMB636.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-225 °C(lit.) |
| Boiling point: | 295.53°C (rough estimate) |
| Density | 1.1184 (rough estimate) |
| refractive index | 1.5954 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 0.03g/l |
| pka | 4.19±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Insoluble in water. |
| BRN | 973519 |
| InChI | 1S/C13H10O2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H,(H,14,15) |
| InChIKey | NNJMFJSKMRYHSR-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)-c2ccccc2 |
| CAS DataBase Reference | 92-92-2(CAS DataBase Reference) |
| NIST Chemistry Reference | [1,1'-Biphenyl]-4-carboxylic acid(92-92-2) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4-carboxylic acid (92-92-2) |
Description and Uses
Biphenyl-4-carboxylic acid is employed in the synthesis, characterization of europium, terbium complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-51-36-22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 1 |
| RTECS | DV1925100 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |




