A1198412
2-(Bromomethyl)naphthalene , 96% , 939-26-4
CAS NO.:939-26-4
Empirical Formula: C11H9Br
Molecular Weight: 221.09
MDL number: MFCD00004123
EINECS: 213-359-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 10g | RMB69.60 | In Stock |
|
| 25G | RMB145.60 | In Stock |
|
| 100G | RMB557.60 | In Stock |
|
| 500g | RMB2054.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-54 °C(lit.) |
| Boiling point: | 213 °C100 mm Hg(lit.) |
| Density | 1.3971 (rough estimate) |
| refractive index | 1.6411 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Very Slightly) |
| form | Fine Crystalline Powder |
| color | Slightly yellow to light beige |
| Water Solubility | Soluble in water (reacts), and chloroform. |
| BRN | 636546 |
| InChI | InChI=1S/C11H9Br/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2 |
| InChIKey | RUHJZSZTSCSTCC-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CBr |
| CAS DataBase Reference | 939-26-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Naphthalene, 2-(bromomethyl)-(939-26-4) |
Description and Uses
2-(Bromomethyl)naphthalene (2-BMN) can be employed as a starting material in the synthesis of 2-(fluoromethyl)naphthalene , 2-naphthylmethyl azide , 2-naphthalenecarboxaldehyde , diselenide, bis(2-naphthalenylmethyl) , 1H-1,2,3-triazole, 4,4′-(1,4-phenylene)bis[1-(2-naphthalenylmethyl).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317 |
| Precautionary statements | P260-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-43-36/37/38-36 |
| Safety Statements | 26-28-36/37/39-45-37-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Keep Cold |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29033036 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B Skin Sens. 1 |
| Limited Quantities | 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







