A1198912
3-Bromo-4-hydroxybenzaldehyde , 97% , 2973-78-6
CAS NO.:2973-78-6
Empirical Formula: C7H5BrO2
Molecular Weight: 201.02
MDL number: MFCD00017348
EINECS: 608-409-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB302.40 | In Stock |
|
| 100G | RMB747.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-135 °C (lit.) |
| Boiling point: | 261.3±20.0 °C(Predicted) |
| Density | 1.737±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 6.24±0.18(Predicted) |
| form | Solid |
| color | White to Pale Yellow |
| Water Solubility | Soluble in water 1.33 g/L. |
| Sensitive | Air Sensitive |
| BRN | 2205318 |
| InChI | InChI=1S/C7H5BrO2/c8-6-3-5(4-9)1-2-7(6)10/h1-4,10H |
| InChIKey | UOTMHAOCAJROQF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(O)C(Br)=C1 |
| CAS DataBase Reference | 2973-78-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 3-bromo-4-hydroxy-(2973-78-6) |
Description and Uses
3-Bromo-4-hydroxybenzaldehyde is an intermediate in organic syntheses, it is used to produce other chemicals like 5-Brom-4-hydroxy-b-nitrostyrol.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






