A1204812
5-Bromo-2-chloro-3-nitropyridine , 98% , 67443-38-3
CAS NO.：67443-38-3
Empirical Formula: C5H2BrClN2O2
Molecular Weight: 237.44
MDL number: MFCD00222270
EINECS: 675-866-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB35.20 | In Stock |
|
| 25g | RMB620.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-70 °C |
| Boiling point: | 285.4±35.0 °C(Predicted) |
| Density | 1.936±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | -4.99±0.10(Predicted) |
| form | Crystalline Powder |
| color | Yellow |
| InChI | InChI=1S/C5H2BrClN2O2/c6-3-1-4(9(10)11)5(7)8-2-3/h1-2H |
| InChIKey | WWQQPSDIIVXFOX-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Br)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 67443-38-3(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-chloro-3-nitropyridine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 36/37/38-21/22-41-37/38-25-22 |
| Safety Statements | 37/39-26-45-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
