A1204912
3-Bromo-2-chloropyridine , 98% , 52200-48-3
CAS NO.：52200-48-3
Empirical Formula: C5H3BrClN
Molecular Weight: 192.44
MDL number: MFCD00234007
EINECS: 629-254-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB89.60 | In Stock |
|
| 100G | RMB371.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C (lit.) |
| Boiling point: | 97 °C / 10mmHg |
| Density | 1.7783 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.63±0.10(Predicted) |
| form | Crystalline Powder, Crystals or Flakes or Solid |
| color | White to yellow |
| BRN | 109812 |
| InChI | InChI=1S/C5H3BrClN/c6-4-2-1-3-8-5(4)7/h1-3H |
| InChIKey | HDYNIWBNWMFBDO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC=C1Br |
| CAS DataBase Reference | 52200-48-3(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-chloropyridine may be used to synthesize:
- acetylenic dipyridone
- 3-ethynyl-2-(phenylmethoxy)-pyridine
- nemertelline
- ortho-chlorodiheteroarylamine4 or 2-chloro-N-(2,3,7-trimethylbenzo[b]thien-6-yl)pyridin-3-amine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
