A1209112
N-Boc-4-oxo-L-proline methyl ester , 97% , 102195-80-2
Synonym(s):
(2S)-4-Oxo-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid methyl ester;tert-Butyl (2S)-2-(methoxycarbonyl)-4-oxopyrrolidine-1-carboxylate;1-tert-Butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
CAS NO.:102195-80-2
Empirical Formula: C11H17NO5
Molecular Weight: 243.26
MDL number: MFCD01861778
EINECS: 625-165-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB44.80 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 10g | RMB127.20 | In Stock |
|
| 25g | RMB306.40 | In Stock |
|
| 100g | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 35-40°C |
| alpha | 14 º (C=1 IN CHLOROFORM) |
| Boiling point: | 333.1±42.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | -3.86±0.40(Predicted) |
| Appearance | Light yellow to brown Solid |
| optical activity | [α]22/D +14.0°, c = 1 in chloroform |
| InChI | InChI=1S/C11H17NO5/c1-11(2,3)17-10(15)12-6-7(13)5-8(12)9(14)16-4/h8H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | UPBHYYJZVWZCOZ-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC(=O)C[C@H]1C(OC)=O |
| CAS DataBase Reference | 102195-80-2(CAS DataBase Reference) |
Description and Uses
(2S)-1-Boc-4-oxo-proline Methyl Ester (cas# 102195-80-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312-H318 |
| Precautionary statements | P280-P301+P312+P330-P302+P352+P312-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-41 |
| Safety Statements | 26-36/37-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Eye Dam. 1 |








