A4719531
N-Boc-L-threonine methyl ester , 95% , 79479-07-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB81.60 | In Stock |
|
| 25G | RMB300.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 206 °C(lit.) |
| Density | 1.123±0.06 g/cm3(Predicted) |
| refractive index | n20/D 1.45(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Dichloromethane (Sparingly), DMF (Sparingly) |
| pka | 11.00±0.46(Predicted) |
| form | Viscous Liquid |
| color | Yellow |
| Water Solubility | Slightly soluble in water. |
| Major Application | peptide synthesis |
| InChI | 1S/C10H19NO5/c1-6(12)7(8(13)15-5)11-9(14)16-10(2,3)4/h6-7,12H,1-5H3,(H,11,14)/t6-,7+/m1/s1 |
| InChIKey | MZMWAPNVRMDIPS-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)O |
Description and Uses
N-Boc-L-threonine methyl ester is used as pharmaceutical intermediates and chemical intermediate.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Warning |
| Hazard statements | H302+H332-H311-H315-H319 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P361-P405-P501c |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 10 - Combustible liquids |







