A1209212
N<sup>4</sup>-Benzoylcytidine , 98% , 13089-48-0
CAS NO.:13089-48-0
Empirical Formula: C16H17N3O6
Molecular Weight: 347.32
MDL number: MFCD00010572
EINECS: 603-444-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB116.00 | In Stock |
|
| 5G | RMB343.20 | In Stock |
|
| 25g | RMB567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-234 °C (dec.)(lit.) |
| Density | 1.59±0.1 g/cm3(Predicted) |
| refractive index | 46 ° (C=1, DMSO) |
| storage temp. | 2-8°C |
| solubility | Soluble in 1N NaOH at 10mg/ml. Also soluble in methanol or DMSO |
| pka | 8.61±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to Off-white |
| optical activity | [α]27/D +55°, c = 0.1 in methanol |
| InChI | 1S/C16H17N3O6/c20-8-10-12(21)13(22)15(25-10)19-7-6-11(18-16(19)24)17-14(23)9-4-2-1-3-5-9/h1-7,10,12-13,15,20-22H,8H2,(H,17,18,23,24)/t10-,12-,13-,15-/m1/s1 |
| InChIKey | BNXBRFDWSPXODM-BPGGGUHBSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=CC(NC(=O)C3=CC=CC=C3)=NC2=O)[C@H](O)[C@@H]1O |
| CAS DataBase Reference | 13089-48-0(CAS DataBase Reference) |
Description and Uses
N4-Benzoylcytidine is a useful building block for oligoribonucleotide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| REACH Registrations | Active |





