A1209312
5-Bromo-1-indanone , 98% , 34598-49-7
Synonym(s):
DDH;DD1;DDH1;E2DH;EDH17B2
CAS NO.:34598-49-7
Empirical Formula: C9H7BrO
Molecular Weight: 211.06
MDL number: MFCD00082718
EINECS: 629-357-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB68.80 | In Stock |
|
| 25G | RMB241.60 | In Stock |
|
| 100G | RMB972.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-129 °C(lit.) |
| Boiling point: | 303.7±31.0 °C(Predicted) |
| Density | 1.18 g/mL at 25 °C(lit.) |
| refractive index | 1.5720 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | Beige to brown |
| biological source | rabbit |
| BRN | 2357199 |
| InChI | InChI=1S/C9H7BrO/c10-7-2-3-8-6(5-7)1-4-9(8)11/h2-3,5H,1,4H2 |
| InChIKey | KSONICAHAPRCMV-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(Br)C=C2)CC1 |
| CAS DataBase Reference | 34598-49-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-inden-1-one, 5-bromo-2,3-dihydro-(34598-49-7) |
Description and Uses
5-Bromo-1-indanone is a 1-indanone derivative. Its physical properties like density, freezing point and refractive index have been determined. It participates in the synthesis of the imidazolyl and triazolyl substituted biphenyl compounds.
Starter for indanone-based pharmaceuticals1,2
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT |
| HS Code | 29147000 |







