A1209412
Boc-propargyl-Gly-OH , 98% , 63039-48-5
Synonym(s):
(S)-2-(Boc-amino)-4-pentynoic acid;Boc-L -2-propargylglycine;Boc-Pra-OH
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB127.20 | In Stock |
|
| 1G | RMB343.20 | In Stock |
|
| 5g | RMB1199.20 | In Stock |
|
| 25g | RMB4159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85.5 °C |
| Boiling point: | 353.22°C (rough estimate) |
| Density | 1.2177 (rough estimate) |
| refractive index | 1.4368 (estimate) |
| storage temp. | -20°C |
| pka | 3.53±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light yellow |
| optical activity | [α]/D 26.0±2.0°, c = 1 in methanol |
| Water Solubility | Soluble in water. |
| BRN | 5739897 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H15NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h1,7H,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 |
| InChIKey | AMKHAJIFPHJYMH-ZETCQYMHSA-N |
| SMILES | C(O)(=O)[C@@H](NC(OC(C)(C)C)=O)CC#C |
| CAS DataBase Reference | 63039-48-5(CAS DataBase Reference) |
Description and Uses
N-Boc-2-propargyl-L-glycine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | Eyeshields, Faceshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |







