A7111212
(R)-N-Boc-Propargylglycine , 95% , 63039-46-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB108.80 | In Stock |
|
| 1G | RMB256.00 | In Stock |
|
| 5G | RMB790.40 | In Stock |
|
| 25g | RMB3276.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88° |
| Boiling point: | 353.22°C (rough estimate) |
| Density | 1.2177 (rough estimate) |
| refractive index | 1.4368 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.53±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light beige |
| optical activity | -32.6364°(C=1.1311 g/100ml CHCL3) |
| InChI | InChI=1S/C10H15NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h1,7H,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m1/s1 |
| InChIKey | AMKHAJIFPHJYMH-SSDOTTSWSA-N |
| SMILES | C(O)(=O)[C@H](NC(OC(C)(C)C)=O)CC#C |
| CAS DataBase Reference | 63039-46-3(CAS DataBase Reference) |
Description and Uses
(R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid is a Glycine.html" class="link-product" target="_blank">Glycine (HY-Y0966) derivative[1]. (R)-2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P260-P280-P301+P312-P302+P352-P304+P340-P361+P364 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| HS Code | 29224985 |
