A1215512
2-Bromo-2′-chloroacetophenone , 95% , 5000-66-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB56.80 | In Stock |
|
| 5G | RMB173.60 | In Stock |
|
| 25g | RMB640.00 | In Stock |
|
| 100g | RMB1360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 105 °C1 mm Hg(lit.) |
| Density | 1.602 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform, Ethyl Acetate, Methanol |
| form | Liquid |
| Specific Gravity | 1.602 |
| color | Colorless to pale yellow |
| Sensitive | Lachrymatory |
| InChI | InChI=1S/C8H6BrClO/c9-5-8(11)6-3-1-2-4-7(6)10/h1-4H,5H2 |
| InChIKey | WZWWEVCLPKAQTA-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC=C1Cl)CBr |
| CAS DataBase Reference | 5000-66-8(CAS DataBase Reference) |
Description and Uses
2’-Chloro-2-bromoacetophenone (cas# 5000-66-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2922 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory/Keep Cold |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29143900 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
