A1216750
Carbamicacidethylester-(ethyl-D5) , 98% , 73962-07-9
Synonym(s):
Carbamic acid ethyl ester-(ethyl-D5);Deuterated urethane;Ethyl-d5 carbamate;Ethylurethane-(ethyl-D5)
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1199.20 | In Stock |
|
| 100mg | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48.5-50 °C(lit.) |
| Boiling point: | 182-184 °C(lit.) |
| Flash point: | 198 °F |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Low-Melting Solid |
| color | White to Light Brown |
| InChI | 1S/C3H7NO2/c1-2-6-3(4)5/h2H2,1H3,(H2,4,5)/i1D3,2D2 |
| InChIKey | JOYRKODLDBILNP-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC(N)=O |
Description and Uses
Labelled Urethane (U825300). Naturally occurring contaminant in fermented foods, particularly wine, stone-fruit brandies, and bread. This substance is reasonably anticipated to be a human carcinogen.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H350 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 45-46-20/21/22-36/37/38 |
| Safety Statements | 53-26-36/37/39-45 |
| WGK Germany | 3 |
| HS Code | 28459000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B |






