A1232512
(S)-(-)-2-Bromopropionic acid , 98% , 32644-15-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB148.00 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 25G | RMB1117.60 | In Stock |
|
| 100G | RMB3197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −35 °C(lit.) |
| Boiling point: | 78 °C4 mm Hg(lit.) |
| Density | 1.696 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | 2-8°C |
| solubility | Acetone, Chloroform, Dichloromethane, Ethyl Acetate |
| pka | 3.00±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless |
| optical activity | [α]20/D 25°, neat |
| BRN | 1720261 |
| InChI | InChI=1S/C3H5BrO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)/t2-/m0/s1 |
| InChIKey | MONMFXREYOKQTI-REOHCLBHSA-N |
| SMILES | C(O)(=O)[C@@H](Br)C |
| CAS DataBase Reference | 32644-15-8(CAS DataBase Reference) |
Description and Uses
Used for the direct enantiomeric assay of carboxylic acids by proton NMR.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
