A1237512
Bromosuccinic acid , 96% , 923-06-8
CAS NO.：923-06-8
Empirical Formula: C4H5BrO4
Molecular Weight: 196.98
MDL number: MFCD00004213
EINECS: 213-087-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 100G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-163 °C(lit.) |
| Boiling point: | 255℃ |
| Density | 2.073 |
| refractive index | 1.4620 (estimate) |
| Flash point: | 108℃ |
| storage temp. | Refrigerator |
| solubility | Insoluble in ether. |
| pka | pK1: 2.55;pK2: 4.41 (25°C) |
| form | Solid |
| color | White |
| Water Solubility | 120g/L(15.5 ºC) |
| Merck | 14,1437 |
| BRN | 1723556 |
| InChI | InChI=1S/C4H5BrO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9) |
| InChIKey | QQWGVQWAEANRTK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Br)CC(O)=O |
| CAS DataBase Reference | 923-06-8(CAS DataBase Reference) |
Description and Uses
Bromosuccinic acid is an important precursor in many chemicals used in the food, chemical and pharmaceutical fields. It is also used as a reagent to prepare L-Hydrazinosuccinic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
