5-Bromo-2-fluoropyridine , 98% , 766-11-0
CAS NO.:766-11-0
Empirical Formula: C5H3BrFN
Molecular Weight: 175.99
MDL number: MFCD01863742
EINECS: 629-380-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 100G | RMB257.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Boiling point: | 162-164 °C750 mm Hg(lit.) |
| Density | 1.71 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -2.79±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless yellow |
| Specific Gravity | 1.710 |
| BRN | 1363171 |
| InChI | InChI=1S/C5H3BrFN/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | MYUQKYGWKHTRPG-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 766-11-0(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-fluoropyridine is a halogenated pyridine that has been used as a molecular scaffold for many Active Pharmaceutical Ingredients (APIs) such as Neuropeptide Y Receptor Y5 Inhibitors, SARS-CoV-2 Major Protease Inhibitors, and Indoleamine-2,3-Dioxygenase-1 Inhibitors in cancer immunotherapy. 5-Bromo-2-fluoropyridine is also an ideal building block for semiconductors, due to its aromaticity and electron deficiency. A host material of 5-(5-(2,4,6-triiso-propylphenyl)pyridin-2-yl)-5H-benzo[d]benzo-[4,5]imidazo[1,2-a]imidazole is synthesized from 5-bromo-2-fluoropyridine for OLED applications.
5-Bromo-2-fluoropyridine is used in the synthesis of heteroaromatic and aniline derivatives of piperidines as potent ligands used for vesicular acetylcholine transport. Also used in the synthesis of benzofurano[3,2-d]pyrimidin-2-one derived inhbitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37-37/39 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| REACH Registrations | Active |






