A1273912
4-Bromobenzenesulfonyl chloride , 98% , 98-58-8
CAS NO.:98-58-8
Empirical Formula: C6H4BrClO2S
Molecular Weight: 255.52
MDL number: MFCD00007437
EINECS: 202-683-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-75 °C (lit.) |
| Boiling point: | 153 °C/15 mmHg (lit.) |
| Density | 1.7910 (estimate) |
| Flash point: | 152-154°C/26mm |
| storage temp. | Refrigerator, Under Inert Atmosphere |
| solubility | soluble in Chloroform, DMSO |
| form | Crystals or Crystalline Powder |
| color | White to beige |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| Merck | 14,1407 |
| BRN | 743518 |
| InChI | InChI=1S/C6H4BrClO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H |
| InChIKey | KMMHZIBWCXYAAH-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(Br)C=C1 |
| CAS DataBase Reference | 98-58-8(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 4-bromo- (98-58-8) |
Description and Uses
4-Bromobenzenesulfonyl chloride is used for identification of amines, and also in the synthesis and inhibition studies of substituted N-L-histidinylphenylsulfonyl hydrazide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049020 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |





