A1288312
4-Bromoisophthalic acid , 96% , 6939-93-1
Synonym(s):
1,3-Dicarboxy-4-bromobenzene;4-Bromo-1,3-benzenedicarboxylic acid;4-Bromoisophthalic acid
CAS NO.:6939-93-1
Empirical Formula: C8H5BrO4
Molecular Weight: 245.03
MDL number: MFCD00002404
EINECS: 230-078-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB181.60 | In Stock |
|
| 25G | RMB629.60 | In Stock |
|
| 10g | RMB695.20 | In Stock |
|
| 100G | RMB2143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 297-299 °C(lit.) |
| Boiling point: | 430.6±40.0 °C(Predicted) |
| Density | 1.8281 (rough estimate) |
| refractive index | 1.4490 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| pka | 2.48±0.10(Predicted) |
| form | Crystalline Powder and Chunks |
| color | White to off-white |
| BRN | 1959392 |
| InChI | 1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | MSQIEZXCNYUWHN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Br)c(c1)C(O)=O |
| CAS DataBase Reference | 6939-93-1(CAS DataBase Reference) |
Description and Uses
4-Bromoisophthalic Acid is an inhibitor of glutamate decarboxylase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | 3 |
| HS Code | 29173990 |
| Storage Class | 13 - Non Combustible Solids |





