A1293512
1-Bromo-3,5-dichlorobenzene , 98% , 19752-55-7
CAS NO.:19752-55-7
Empirical Formula: C6H3BrCl2
Molecular Weight: 225.9
MDL number: MFCD00000584
EINECS: 243-270-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB151.20 | In Stock |
|
| 500g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-75 °C(lit.) |
| Boiling point: | 232 °C757 mm Hg(lit.) |
| Density | 1.6351 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| Flash point: | 232°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to beige-brown |
| BRN | 1931524 |
| InChI | InChI=1S/C6H3BrCl2/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | DZHFFMWJXJBBRG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(Cl)=C1 |
| CAS DataBase Reference | 19752-55-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-3,5-dichloro-(19752-55-7) |
| EPA Substance Registry System | Benzene, 1-bromo-3,5-dichloro- (19752-55-7) |
Description and Uses
1-Bromo-3,5-dichlorobenzene, is a building block used in the synthesis of halogenated chemical compounds, such as polychlorinated biphenyls (PCBs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





