A1296712
2′,7′-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein , 90% , 85138-49-4
Synonym(s):
BCECF
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB502.56 | In Stock |
|
| 5MG | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -20°C |
| solubility | DMF: 5 mg/ml; DMSO: 15 mg/ml; DMSO:PBS (pH 7.2) (1:2): 0.25 mg/ml; Ethanol: 5 mg/ml |
| form | A crystalline solid |
| color | Yellow to orange |
| Appearance | Solid Powder |
| ex/em | λex 484 nm; λem 520 nm; pH 5.5 |
| BRN | 8375770 |
| InChIKey | DKROGDOAOXDINY-UHFFFAOYSA-N |
| SMILES | OC(=O)CCc1cc2c(OC3=CC(=O)C(CCC(O)=O)=CC3=C2c4cc(ccc4C(O)=O)C(O)=O)cc1O |
Description and Uses
BCECF is a fluorescent cytoplasmic pH-sensitive indicator. pH is measured by the ratio of emission intensity.
2′,7′-Bis(2-carboxyethyl)-5(6)-carboxyfluorescein has been used in a fluorescence-based screening assay, to determine the pH.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 8 |
| Storage Class | 11 - Combustible Solids |






