A4070212
4-Ethylbenzoic Acid , ≥98.0% , 619-64-7
CAS NO.:619-64-7
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD00002570
EINECS: 210-605-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.80 | In Stock |
|
| 25G | RMB36.00 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 500G | RMB368.00 | In Stock |
|
| 2.5kg | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-113 °C(lit.) |
| Boiling point: | 271.51°C (estimate) |
| Density | 1.0937 (estimate) |
| refractive index | 1.5188 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| pka | pK1:4.35 (25°C) |
| form | Powder |
| color | White to beige |
| BRN | 2041840 |
| InChI | InChI=1S/C9H10O2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | ZQVKTHRQIXSMGY-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(CC)C=C1 |
| CAS DataBase Reference | 619-64-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Ethylbenzoic acid(619-64-7) |
| EPA Substance Registry System | Benzoic acid, 4-ethyl- (619-64-7) |
Description and Uses
4-Ethylbenzoic acid was used in the synthesis of ethyl 4-vinyl-α-cyano-β-phenylcinnamate. It was also used to functionalize the edge of “pristine” graphite in the presence of polyphosphoric acid/phosphorus pentoxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |






