A1299712
2,6-Bis[(4R)-(+)-isopropyl-2-oxazolin-2-yl]pyridine , 98% , 131864-67-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB144.00 | In Stock |
|
| 1G | RMB366.40 | In Stock |
|
| 5G | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154-156 °C(lit.) |
| alpha | +118° (c 1.0, CH2Cl2) |
| Boiling point: | 457.1±30.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| refractive index | 118 ° (C=1, CH2Cl2) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| pka | 3.78±0.70(Predicted) |
| color | white |
| optical activity | [α]20/D +118°, c = 0.7 in methylene chloride |
| InChI | InChI=1S/C17H23N3O2/c1-10(2)14-8-21-16(19-14)12-6-5-7-13(18-12)17-20-15(9-22-17)11(3)4/h5-7,10-11,14-15H,8-9H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | CSGQGLBCAHGJDR-GJZGRUSLSA-N |
| SMILES | C1(C2=N[C@H](C(C)C)CO2)=NC(C2=N[C@H](C(C)C)CO2)=CC=C1 |
Description and Uses
C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![2,6-Bis[(4R)-(+)-isopropyl-2-oxazolin-2-yl]pyridine](https://img.chemicalbook.com/CAS/GIF/131864-67-0.gif)

![2,6-Bis[(4R)-4-tert-butyloxazolin-2-yl]pyridine](https://img.chemicalbook.com/CAS/GIF/185346-17-2.gif)

![N-Benzylquininium Chloride [Chiral Phase-Transfer Catalyst]](https://img.chemicalbook.com/CAS/GIF/67174-25-8.gif)
![2,6-Bis[(4S)-4-tert-butyloxazolin-2-yl]pyridine](https://img.chemicalbook.com/CAS/GIF/118949-63-6.gif)