A1301112
(R)-(-)-1,1'-Bi-2-naphthol Bis(trifluoromethanesulfonate) , 98% , 126613-06-7
Synonym(s):
(R)-1,1′-Bi(2-naphthol) bis(trifluoromethanesulfonate);(R)-1,1′-Binaphthalene-2,2′-diyl bis(trifluoromethanesulfonate)
CAS NO.:126613-06-7
Empirical Formula: C22H12F6O6S2
Molecular Weight: 550.45
MDL number: MFCD00274615
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB110.40 | In Stock |
|
| 1G | RMB148.00 | In Stock |
|
| 5G | RMB492.80 | In Stock |
|
| 25g | RMB2001.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-85 °C(lit.) |
| Boiling point: | 578.8±50.0 °C(Predicted) |
| alpha | -149 º (c=1, CHCl3) |
| Density | 1.5402 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | White |
| optical activity | [α]23/D 146°, c = 1 in chloroform |
| Water Solubility | Insoluble |
| Sensitive | moisture sensitive |
| BRN | 4282753 |
| InChI | InChI=1S/C22H12F6O6S2/c23-21(24,25)35(29,30)33-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)34-36(31,32)22(26,27)28/h1-12H |
| InChIKey | OYJLCOSEYYZULE-UHFFFAOYSA-N |
| SMILES | C1(=C(OS(=O)(=O)C(F)(F)F)C=CC2C=CC=CC1=2)C1C(OS(=O)(=O)C(F)(F)F)=CC=C2C=CC=CC=12 |
| CAS DataBase Reference | 126613-06-7(CAS DataBase Reference) |
Description and Uses
(R)-(?)-1,1′-Bi-2-naphthol bis(trifluoromethanesulfonate) can be used:
- In the synthesis of heterobidentate ligands for asymmetric catalysis.
- To prepare 2-(diphenylphosphino)-2′-alkoxy-1,1′-binaphthyls by reacting with bis(aryl) phosphonic acids.
- As a starting material for the synthesis of binaphthyl based rhodium catalysts used in the hydrogenation of styrene.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29072990 |






