A1308112
Boc-3-(2 naphthyl)-L-alanine , 98% , 58438-04-3
Synonym(s):
Boc-3-(2-naphthyl)-L -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB184.00 | In Stock |
|
| 25G | RMB704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C(lit.) |
| Boiling point: | 454.92°C (rough estimate) |
| Density | 1.2164 (rough estimate) |
| refractive index | 1.5740 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Ethanol |
| form | Solid |
| pka | 3.88±0.30(Predicted) |
| color | Off-white |
| optical activity | [α]20/D +45±2°, c = 1% in ethanol |
| BRN | 4326467 |
| Major Application | peptide synthesis |
| InChI | 1S/C18H21NO4/c1-18(2,3)23-17(22)19-15(16(20)21)11-12-8-9-13-6-4-5-7-14(13)10-12/h4-10,15H,11H2,1-3H3,(H,19,22)(H,20,21)/t15-/m0/s1 |
| InChIKey | URKWHOVNPHQQTM-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(O)=O |
| CAS DataBase Reference | 58438-04-3(CAS DataBase Reference) |
Description and Uses
N-Boc-3-(2-naphthyl)-L-alanine Functions as a reagent for the synthesis of dipeptidyl nitriles as potent and reversible inhibitors of Cathepsin C
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |





