A1309512
Boc-4-Iodo-L-phenylalanine , 99% , 62129-44-6
Synonym(s):
Boc-4-iodo-L -phenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB42.40 | In Stock |
|
| 5G | RMB141.60 | In Stock |
|
| 25G | RMB599.20 | In Stock |
|
| 100g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~150 °C (dec.) |
| alpha | 22.5 º (c=1% in ethyl acetate) |
| Boiling point: | 475.3±40.0 °C(Predicted) |
| Density | 1.560±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.84±0.10(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +22.5±3°, c = 1% in ethyl acetate |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Light Sensitive |
| BRN | 4503851 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C14H18INO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | JZLZDBGQWRBTHN-NSHDSACASA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(I)C=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 62129-44-6(CAS DataBase Reference) |
Description and Uses
N-Boc-4-iodo-L-phenylalanine is used as pharmaceutical intermediate. It is also used as a p-iodo phenyl alanine derivative with N-Boc protection.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| F | 8 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |






