A1310512
Boc-D-Alaninol , 98%,ee98% , 106391-86-0
Synonym(s):
(R)-(+)-2-(tert-Butoxycarbonylamino)-1-propanol;N-Boc-D -alaninol
CAS NO.:106391-86-0
Empirical Formula: C8H17NO3
Molecular Weight: 175.23
MDL number: MFCD00235912
EINECS: 807-082-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.80 | In Stock |
|
| 5G | RMB43.20 | In Stock |
|
| 25G | RMB141.60 | In Stock |
|
| 100G | RMB454.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 58-61 °C(lit.) |
| alpha | 11 º (c=1 in chloroform) |
| Boiling point: | 276.4±23.0 °C(Predicted) |
| Density | 1.025±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.11±0.46(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D +11°, c = 1 in chloroform |
| InChI | InChI=1S/C8H17NO3/c1-6(5-10)9-7(11)12-8(2,3)4/h6,10H,5H2,1-4H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | PDAFIZPRSXHMCO-ZCFIWIBFSA-N |
| SMILES | C(OC(C)(C)C)(=O)N[C@H](C)CO |
| CAS DataBase Reference | 106391-86-0(CAS DataBase Reference) |
Description and Uses
Used in the synthesis of antithrombotic nipecotamides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29051990 |







