A1311112
                    N-Boc-D-phenylalaninol , 98% , 106454-69-7
                            Synonym(s):
(R)-(+)-2-(tert-Butoxycarbonylamino)-3-phenyl-1-propanol;(R)-2-(Boc-amino)-3-phenyl-1-propanol;N-(tert-Butoxycarbonyl)-D -phenylalaninol
                            
                        
                CAS NO.:106454-69-7
Empirical Formula: C14H21NO3
Molecular Weight: 251.32
MDL number: MFCD00216472
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB45.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB182.40 | In Stock | 
                                                 | 
                                        
| 100G | RMB683.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 95-98 °C (lit.) | 
                                    
| Boiling point: | 394.48°C (rough estimate) | 
                                    
| alpha | +24°(23℃, c=1, CHCl3) | 
                                    
| Density | 1.0696 (rough estimate) | 
                                    
| refractive index | 1.5280 (estimate) | 
                                    
| storage temp. | Sealed in dry,2-8°C | 
                                    
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | 
                                    
| form | Powder | 
                                    
| pka | 12.07±0.46(Predicted) | 
                                    
| Appearance | White to off-white Solid | 
                                    
| optical activity | [α]23/D +24°, c = 1 in chloroform | 
                                    
| BRN | 4686134 | 
                                    
| InChI | InChI=1S/C14H21NO3/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11/h4-8,12,16H,9-10H2,1-3H3,(H,15,17)/t12-/m1/s1 | 
                                    
| InChIKey | LDKDMDVMMCXTMO-GFCCVEGCSA-N | 
                                    
| SMILES | C(OC(C)(C)C)(=O)N[C@@H](CO)CC1=CC=CC=C1 | 
                                    
| CAS DataBase Reference | 106454-69-7(CAS DataBase Reference) | 
                                    
Description and Uses
Protected D-Phenylalaninol, an intermediate in the preparation of (S)-Amphetamine.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Safety Statements | 24/25 | 
| WGK Germany | 3 | 
| F | 9-21 | 
| HS Code | 29225090 | 







