A1316012
tert-Butyl (S)-2-pyrrolidone-5-carboxylate , 98% , 35418-16-7
Synonym(s):
tert-Butyl (S)-5-oxo-2-pyrrolidinecarboxylate;tert-Butyl L -pyroglutamate;tert-Butyl 5-oxo-L -prolinate
CAS NO.:35418-16-7
Empirical Formula: C9H15NO3
Molecular Weight: 185.22
MDL number: MFCD06659481
EINECS: 252-555-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB244.80 | In Stock |
|
| 100G | RMB821.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 102.0 to 108.0 °C |
| Boiling point: | 319.2±35.0 °C(Predicted) |
| Density | 1.099±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 14.65±0.40(Predicted) |
| form | Powder |
| color | White |
| BRN | 3590226 |
| InChI | 1S/C9H15NO3/c1-9(2,3)13-8(12)6-4-5-7(11)10-6/h6H,4-5H2,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | QXGSPAGZWRTTOT-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(=O)N1 |
Description and Uses
tert-Butyl (S)-2-pyrrolidone-5-carboxylate can be used:
- As a starting material/synthon in the synthesis of angiotensin-converting enzyme inhibitors.
- In the synthesis of phenanthroindolizidine alkaloids named (+)-tylophorine and antofine.
- As a starting material in the synthesis of radioligands [18F]IUR-1602 and [18F]IUR-1601, applicable for imaging of P2X7R, a therapeutic target for neuroinflammation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |







