A1323812
4-Benzyloxyindole , 99% , 20289-26-3
Synonym(s):
NSC 92539
CAS NO.:20289-26-3
Empirical Formula: C15H13NO
Molecular Weight: 223.27
MDL number: MFCD00047200
EINECS: 243-690-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB95.20 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25G | RMB1039.20 | In Stock |
|
| 100G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-61 °C (lit.) |
| Boiling point: | 364.56°C (rough estimate) |
| Density | 1.0707 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 17.17±0.30(Predicted) |
| color | Beige to Brown |
| BRN | 183150 |
| InChI | InChI=1S/C15H13NO/c1-2-5-12(6-3-1)11-17-15-8-4-7-14-13(15)9-10-16-14/h1-10,16H,11H2 |
| InChIKey | LJFVSIDBFJPKLD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(OCC3=CC=CC=C3)=CC=C2)C=C1 |
| CAS DataBase Reference | 20289-26-3(CAS DataBase Reference) |
Description and Uses
4-Benzyloxyindole was used in the synthesis of 4-alkyloxy-aminoalkyl indole derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





