A1324512
N6-Benzoyl-5′-O-(4,4′-dimethoxytrityl)-2′-deoxyadenosine , 99% , 64325-78-6
CAS NO.：64325-78-6
Empirical Formula: C38H35N5O6
Molecular Weight: 657.71
MDL number: MFCD00010058
EINECS: 264-776-4
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB132.00 | In Stock |
|
| 5G | RMB1160.00 | In Stock |
|
| 1G | RMB1303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94 °C |
| Boiling point: | 681.42°C (rough estimate) |
| Density | 1.2199 (rough estimate) |
| refractive index | -10 ° (C=1, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | powder to crystal |
| pka | 7.87±0.43(Predicted) |
| color | White to Almost white |
| Water Solubility | 140μg/L at 20℃ |
| Stability: | Acid Sensitive |
| InChIKey | LPICNYATEWGYHI-RLHFKRISNA-N |
| SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3=C(C(=NC=N3)NC(=O)C3=CC=CC=C3)N=C2)C[C@@H]1O |&1:25,27,47,r| |
| LogP | 5.94 at 20℃ |
| CAS DataBase Reference | 64325-78-6(CAS DataBase Reference) |
| EPA Substance Registry System | Adenosine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy- (64325-78-6) |
Description and Uses
N6-Benzoyl-5'-O-(4,4'-dimethoxytrityl)-2'-deoxyadenosine is useful in various DNA and RNA projects ranging from modification to site-??selective activation, and many other projects.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P501-P261-P272-P280-P302+P352-P362+P364-P333+P313 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 1-3-10 |
| HS Code | 29349990 |
