A1327812
5-Bromo-2-fluorobenzotrifluoride , 98% , 393-37-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100g | RMB284.80 | In Stock |
|
| 500g | RMB1143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203 °C(Solv: hexane (110-54-3)) |
| Boiling point: | 79-80 °C/50 mmHg (lit.) |
| Density | 1.72 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.720 |
| color | Clear colorless to pale yellow |
| Water Solubility | Soluble in water 700 g/L (20°C) |
| BRN | 2643550 |
| InChI | InChI=1S/C7H3BrF4/c8-4-1-2-6(9)5(3-4)7(10,11)12/h1-3H |
| InChIKey | AJLIJYGWAXPEOK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(Br)C=C1C(F)(F)F |
| CAS DataBase Reference | 393-37-3(CAS DataBase Reference) |
Description and Uses
5-Bromo-2-fluorobenzotrifluoride may be used in the preparation of:
- 3,5-bis(4-fluoro-3-trifluoromethylphenyl)phenol
- 9,9-bis(2-ethylhexyl)-2,7-bis[4-fluoro-3-trifluoromethylphenyl]-9H-fluorene
- 3-trifluoromethyl-4-fluoro phenyl boronic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 23-24/25-36-26-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |






