A1331512
2,1,3-Benzothiadiazole , 98% , 273-13-2
Synonym(s):
Piazthiole
CAS NO.:273-13-2
Empirical Formula: C6H4N2S
Molecular Weight: 136.17
MDL number: MFCD00005809
EINECS: 205-985-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10g | RMB47.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C (lit.) |
| Boiling point: | 206 °C (lit.) |
| Density | 1.323 (estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 203 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol almost transparent. |
| form | Low Melting Solid |
| pka | 0.37±0.33(Predicted) |
| color | Colorless to white to pale yellow |
| BRN | 112408 |
| InChI | InChI=1S/C6H4N2S/c1-2-4-6-5(3-1)7-9-8-6/h1-4H |
| InChIKey | PDQRQJVPEFGVRK-UHFFFAOYSA-N |
| SMILES | N1=C2C=CC=CC2=NS1 |
| CAS DataBase Reference | 273-13-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,1,3-Benzothiadiazole(273-13-2) |
| EPA Substance Registry System | 2,1,3-Benzothiadiazole (273-13-2) |
Description and Uses
2,1,3-Benzothiadiazole is a chemical reagent used in the synthesis of supramolecules as well as the synthesis of benzothiadiazole derivatives via cross coupling.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338-P362+P364 |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | DM2580000 |
| TSCA | Yes |
| HS Code | 29349990 |






![Benzo[c][1,2,5]thiadiazole-5-carbohydrazide](https://img.chemicalbook.com/CAS/GIF/98550-17-5.gif)