A1332212
2-Bromo-5-fluorobenzotrifluoride , 97% , 40161-55-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB62.40 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 500g | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 136-143 °C(lit.) |
| Density | 1.695 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 147 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| BRN | 2643544 |
| InChI | InChI=1S/C7H3BrF4/c8-6-2-1-4(9)3-5(6)7(10,11)12/h1-3H |
| InChIKey | AIDVAZGOACECLJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(F)C=C1C(F)(F)F |
| CAS DataBase Reference | 40161-55-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-5-fluorobenzotrifluoride(40161-55-5) |
Description and Uses
2-Bromo-5-fluorobenzotrifluoride is an organofluorobenzene compound mainly used as an organic reagent and pharmaceutical intermediate, and can be used as a starting material for the preparation of HSD-016. HSD-016 inhibits 11β-hydroxysteroid dehydrogenase (11β-HSD1) to convert cortisone into cortisol for the development of drugs for the treatment of type 2 diabetes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H227-H315-H319 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a-P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-37-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
