A1334112
6-Bromo-2-naphthol , 97% , 15231-91-1
CAS NO.:15231-91-1
Empirical Formula: C10H7BrO
Molecular Weight: 223.07
MDL number: MFCD00004081
EINECS: 239-279-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB52.00 | In Stock |
|
| 100G | RMB172.80 | In Stock |
|
| 500G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-124 °C (lit.) |
| Boiling point: | 130°C (rough estimate) |
| Density | 1.4412 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | 9.26±0.40(Predicted) |
| form | Powder |
| color | Off-white to beige |
| BRN | 1100270 |
| InChI | InChI=1S/C10H7BrO/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h1-6,12H |
| InChIKey | YLDFTMJPQJXGSS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(Br)C=C2)=CC=C1O |
| CAS DataBase Reference | 15231-91-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthalenol, 6-bromo-(15231-91-1) |
| EPA Substance Registry System | 6-Bromo-2-naphthol (15231-91-1) |
Description and Uses
6-Bromo-2-naphthol is a flavonoid molecule that shows steroid hormone activity and may be useful on anticancer therapy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | QL3365000 |
| Hazard Note | Irritant |
| HS Code | 29037990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





