A1335012
3,5-Bis(trifluoromethyl)benzoic Acid , 98% , 725-89-3
CAS NO.:725-89-3
Empirical Formula: C9H4F6O2
Molecular Weight: 258.12
MDL number: MFCD00000388
EINECS: 211-970-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB49.60 | In Stock |
|
| 10g | RMB83.20 | In Stock |
|
| 25G | RMB126.40 | In Stock |
|
| 100G | RMB415.20 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-143 °C(lit.) |
| Boiling point: | 223.9±40.0 °C(Predicted) |
| Density | 1,42 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| pka | 3.34±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Slightly soluble in water. |
| BRN | 2058600 |
| InChI | InChI=1S/C9H4F6O2/c10-8(11,12)5-1-4(7(16)17)2-6(3-5)9(13,14)15/h1-3H,(H,16,17) |
| InChIKey | HVFQJWGYVXKLTE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 725-89-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzoic acid(725-89-3) |
Description and Uses
3,5-Bis(trifluoromethyl)benzoic acid is a useful synthetic intermediate, and is a derivative of Benzoic acid (B203900). 3,5-Bis(trifluoromethyl)benzoic acid has also been identified as a major metabolite of a series of 3,5-bis(trifluoromethyl)benzyl ethers in vitro, and is hypothesized to result via oxidation of the benzylic position.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | DG4448020 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







