A1286712
1,3-Bis(trifluoromethyl)-5-bromobenzene , 97% , 328-70-1
Synonym(s):
1-Bromo-3,5-bis(trifluoromethyl)benzene;3,5-Bis(trifluoromethyl)bromobenzene
CAS NO.:328-70-1
Empirical Formula: C8H3BrF6
Molecular Weight: 293
MDL number: MFCD00000381
EINECS: 206-334-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10G | RMB31.20 | In Stock |
|
| 25G | RMB33.60 | In Stock |
|
| 50G | RMB55.20 | In Stock |
|
| 100G | RMB79.20 | In Stock |
|
| 250G | RMB199.20 | In Stock |
|
| 500G | RMB356.80 | In Stock |
|
| 1kg | RMB615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −16 °C(lit.) |
| Boiling point: | 154 °C(lit.) |
| Density | 1.699 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Sparingly) |
| form | Liquid |
| Specific Gravity | 1.699 |
| color | Clear colorless to slightly yellow |
| Water Solubility | Immiscible with water. |
| BRN | 2123669 |
| InChI | 1S/C8H3BrF6/c9-6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | CSVCVIHEBDJTCJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Br)cc(c1)C(F)(F)F |
| CAS DataBase Reference | 328-70-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)bromobenzene(328-70-1) |
Description and Uses
1,3-Bis(trifluoromethyl)-5-bromobenzene is used to prepare the tetrakis[3,5-bis(trifluoromethyl)phenyl]borate ion, which acts as a stabilizing counterion for electrophilic organic and organometallic cations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29036990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







