A1335112
3,5-Bis(trifluoromethyl)benzoyl chloride , 97% , 785-56-8
CAS NO.:785-56-8
Empirical Formula: C9H3ClF6O
Molecular Weight: 276.56
MDL number: MFCD00000387
EINECS: 212-322-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB36.80 | In Stock |
|
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB288.80 | In Stock |
|
| 100g | RMB896.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 5-10C |
| Boiling point: | 65-67 °C (12 mmHg) |
| Density | 1.526 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| form | Liquid |
| Specific Gravity | 1.526 (20/4℃) |
| color | Clear colorless to very slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2593440 |
| InChI | 1S/C9H3ClF6O/c10-7(17)4-1-5(8(11,12)13)3-6(2-4)9(14,15)16/h1-3H |
| InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)C(Cl)=O |
| CAS DataBase Reference | 785-56-8(CAS DataBase Reference) |
Description and Uses
3,5-Bis(trifluoromethyl)benzoyl chloride was used in the quantitative and selective assay for the measurement of low levels of clonidine in human plasma.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37-36 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







