A1335650
5-Chloro-2-nitrobenzylalcohol , 98% , 73033-58-6
CAS NO.:73033-58-6
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00007291
EINECS: 277-241-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB64.00 | In Stock |
|
| 5g | RMB220.80 | In Stock |
|
| 25g | RMB608.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-79 °C (lit.) |
| Boiling point: | 316℃ |
| Density | 1.476 |
| refractive index | 1.6000 (estimate) |
| Flash point: | 145℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystalline solid |
| pka | 13.50±0.10(Predicted) |
| color | off-white to faint red |
| InChI | 1S/C7H6ClNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-3,10H,4H2 |
| InChIKey | ULYZTHQGJXPEFT-UHFFFAOYSA-N |
| SMILES | OCc1cc(Cl)ccc1[N+]([O-])=O |
Description and Uses
5-Chloro-2-nitrobenzyl alcohol was used in the synthesis of carbamates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-51 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






