A1336512
9-Bromophenanthrene , 98% , 573-17-1
CAS NO.：573-17-1
Empirical Formula: C14H9Br
Molecular Weight: 257.13
MDL number: MFCD00001174
EINECS: 209-351-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 250G | RMB959.20 | In Stock |
|
| 500g | RMB1700.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-64 °C (lit.) |
| Boiling point: | 180-190 °C/2 mmHg (lit.) |
| Density | 1.4251 (rough estimate) |
| refractive index | 1.6404 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: 50 mg/mL, clear |
| form | Powder |
| color | Light yellow |
| BRN | 1869927 |
| InChI | InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
| InChIKey | RSQXKVWKJVUZDG-UHFFFAOYSA-N |
| SMILES | C1=C2C(C3C(C(Br)=C2)=CC=CC=3)=CC=C1 |
| CAS DataBase Reference | 573-17-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenanthrene, 9-bromo-(573-17-1) |
Description and Uses
9-Bromophenanthrene is a luminescent material that fluoresces at short wavelengths and can be used as a molecular probe to detect the presence of other compounds and the mechanism of reaction, among other things.
9-Bromophenanthrene is used as halogenated building block. Isotope labelled 9-Bromophenanthrene (B687200), a halogenated polycyclic aromatic hydrocarbon that has been seen to have a room temperature phosphorescence that can be induced by β-cyclodextrin (β-CD) in the presence of cyclohexane; however, trace Fe(III) causes a decrease of the RTP emission.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | SF7197000 |
| F | 8 |
| Hazard Note | Irritant |
| HS Code | 29036990 |
| Storage Class | 11 - Combustible Solids |
